CymitQuimica logo

CAS 78553-51-2

:

Cbz-Alpha-Allyl-L-Gly

Description:
Cbz-Alpha-Allyl-L-Gly, also known as Carbobenzyloxy-α-allyl-L-glycine, is an amino acid derivative characterized by the presence of a carbobenzyloxy (Cbz) protecting group on the amino group and an allyl group attached to the alpha carbon. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but has limited solubility in water. The Cbz group serves to protect the amino functionality during peptide synthesis, making it a valuable intermediate in the production of peptides and other bioactive compounds. The allyl substituent can participate in various chemical reactions, including cross-coupling and polymerization, providing versatility in synthetic applications. Cbz-Alpha-Allyl-L-Gly is often utilized in research and development within the fields of medicinal chemistry and biochemistry, particularly in the synthesis of complex molecules and the study of peptide interactions. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C13H15NO4
InChI:InChI=1S/C13H15NO4/c1-2-6-11(12(15)16)14-13(17)18-9-10-7-4-3-5-8-10/h2-5,7-8,11H,1,6,9H2,(H,14,17)(H,15,16)/t11-/m0/s1
InChI key:DGEZDWGCGXHLEW-NSHDSACASA-N
SMILES:C=CC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1
Found 5 products.