CAS 78554-68-4

2,3,5,6,8,9-Hexahydro-1,4,7,10-benzotetraoxacyclododecin-12-amine

Description:

2,3,5,6,8,9-Hexahydro-1,4,7,10-benzotetraoxacyclododecin-12-amine, with the CAS number 78554-68-4, is a complex organic compound characterized by its unique bicyclic structure that incorporates both a benzene ring and a tetraoxacyclododecin framework. This compound features multiple oxygen atoms integrated into its cyclic structure, contributing to its potential reactivity and solubility properties. The presence of an amine functional group suggests that it may exhibit basic characteristics and could participate in various chemical reactions, such as nucleophilic substitutions. Its hexahydro configuration indicates saturation in certain parts of the molecule, which may influence its stability and interactions with other substances. The compound's intricate structure may also suggest potential applications in medicinal chemistry or materials science, although specific applications would depend on further research into its biological activity and physical properties. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in various fields.

Formula: C₁₂H₁₇NO₄

InChI: InChI=1S/C12H17NO4/c13-10-1-2-11-12(9-10)17-8-6-15-4-3-14-5-7-16-11/h1-2,9H,3-8,13H2

InChI key: InChIKey=ZKICIJKRTPWQSI-UHFFFAOYSA-N

SMILES: NC=1C=C2C(=CC1)OCCOCCOCCO2

Synonyms:

• 4′-Aminobenzo-12-crown-4
• 1,4,7,10-Benzotetraoxacyclododecin-12-amine, 2,3,5,6,8,9-hexahydro-
• 2,3,5,6,8,9-Hexahydro-1,4,7,10-benzotetraoxacyclododecin-12-amine
• 4-Aminobenzo-12-crown-4

4-Aminobenzo-12-crown-4

CAS: 78554-68-4

Formula: C₁₂H₁₇NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.2677

Ref: IN-DA00G3MW

4-Aminobenzo-12-crown-4

CAS: 78554-68-4

4-Aminobenzo-12-crown-4

Purity: 98%

Molecular weight: 239.27g/mol

Ref: 54-OR1034015

4-Aminobenzo-12-crown-4

CAS: 78554-68-4

Purity: 98%

Molecular weight: 239.12

Ref: 10-F551611

4-AMinobenzo-12-crown-4

CAS: 78554-68-4

4-Aminobenzo-12-crown-4 is a neutral, colorless, water soluble compound with an ethyl alcohol, dimethylsulfoxide and mesoporous structure. It is used as a solvent for industrial purposes such as in the production of polyurethane coatings and in the manufacture of paints and varnishes. It also has absorbing properties, which can be utilized to extract lithium from brines. 4-Aminobenzo-12-crown-4 is used as a catalyst in the filtration process.

Formula: C₁₂H₁₇NO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 239.27 g/mol

Ref: 3D-DDA55468