
CAS 78555-37-0
:2-Methyl-N-4-piperidinylpropanamide
Description:
2-Methyl-N-4-piperidinylpropanamide, identified by its CAS number 78555-37-0, is a chemical compound that belongs to the class of amides. It features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, contributing to its potential biological activity. The presence of the methyl group and the propanamide functional group indicates that it may exhibit specific steric and electronic properties, influencing its interactions in biological systems. This compound is often studied for its pharmacological potential, particularly in the context of central nervous system activity, due to the piperidine moiety. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 2-Methyl-N-4-piperidinylpropanamide represents a compound of interest in medicinal chemistry and pharmacology, warranting further investigation into its properties and applications.
Formula:C9H18N2O
InChI:InChI=1S/C9H18N2O/c1-7(2)9(12)11-8-3-5-10-6-4-8/h7-8,10H,3-6H2,1-2H3,(H,11,12)
InChI key:InChIKey=BNCQNRLNKWZODO-UHFFFAOYSA-N
SMILES:N(C(C(C)C)=O)C1CCNCC1
Synonyms:- Propanamide, 2-methyl-N-4-piperidinyl-
- 2-Methyl-N-4-piperidinylpropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.