CAS 78563-03-8
:2,2′-Methylenebis[4-bromophenol]
Description:
2,2′-Methylenebis[4-bromophenol], with the CAS number 78563-03-8, is an organic compound characterized by its structure, which features two 4-bromophenol units linked by a methylene bridge. This compound typically appears as a solid and is known for its applications in various fields, including materials science and organic synthesis. It exhibits properties such as good thermal stability and potential for use as a flame retardant due to the presence of bromine atoms, which can enhance its fire-resistant characteristics. Additionally, the compound may demonstrate antimicrobial properties, making it of interest in biocidal applications. Its solubility can vary depending on the solvent, and it may undergo reactions typical of phenolic compounds, such as etherification or esterification. Safety data should be consulted, as brominated compounds can pose environmental and health risks. Overall, 2,2′-Methylenebis[4-bromophenol] is a versatile compound with significant industrial relevance.
Formula:C13H10Br2O2
InChI:InChI=1/C13H10Br2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2
InChI key:InChIKey=FGDRHERYMWECPV-UHFFFAOYSA-N
SMILES:C(C1=C(O)C=CC(Br)=C1)C2=C(O)C=CC(Br)=C2
Synonyms:- 2,2′-Methylenebis(4-bromophenol)
- Bis(2-hydroxy-5-bromophenyl)methane
- Phenol, 2,2'-Methylenebis[4-Bromo-
- 5,5'-dibromo-2,2'-dihydroxy-diphenyl-methane
- -Methylenebis(4-bromophenol)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,2'-Methylenebis(4-bromophenol)
CAS:Controlled ProductApplications 2,2'-Methylenebis(4-bromophenol) can be derived from bromophenols from the red alga Odonthalia corymbifera and display potential antimicrobial activity. It is used as an intermediate in the synthesis of Albuterol Dimer (A514515) which is an impurity of the drug Albuterol used to treat asthma.
References Oh, K., et al.: Bioorg. Med. Chem. Lett., 18, 104 (2008); Haddad, N., et al.: Tetrahedron Lett., 43, 1135 (2002);Formula:C24H34O4Color and Shape:NeatMolecular weight:386.5242,2-Methylenebis(4-bromophenol)
CAS:2,2-Methylenebis(4-bromophenol) is an analog of inhibitors that target protein kinases. This compound has shown potential as a medicinal anticancer agent due to its ability to induce apoptosis in human cancer cells. It inhibits the cell cycle and tumor growth in Chinese hamster ovary (CHO) cells. Additionally, 2,2-Methylenebis(4-bromophenol) has been found to be excreted in urine and may have diagnostic potential for detecting cancer. Its mechanism of action involves the inhibition of protein kinases, which are involved in various cellular processes such as signal transduction and cell division. This compound holds promise as a potential therapeutic agent for cancer treatment.Formula:C13H10Br2O2Purity:Min. 95%Molecular weight:358.02 g/mol

