CAS 78570-35-1

4'-(methylsulfanyl)-2,2':6',2''-terpyridine

Description:

4'-(Methylsulfanyl)-2,2':6',2''-terpyridine, with the CAS number 78570-35-1, is a chemical compound characterized by its unique structure, which includes a terpyridine backbone modified with a methylsulfanyl group. This compound typically exhibits properties such as solubility in organic solvents, which is common for many terpyridine derivatives. The presence of the methylsulfanyl group can influence its electronic properties, potentially enhancing its ability to act as a ligand in coordination chemistry. Terpyridines are known for their chelating ability, allowing them to form stable complexes with various metal ions, making them valuable in catalysis and materials science. Additionally, the compound may exhibit interesting photophysical properties, which can be utilized in applications such as sensors or light-harvesting systems. Its biological activity, if any, would depend on the specific interactions facilitated by the terpyridine structure and the methylsulfanyl substituent. Overall, 4'-(methylsulfanyl)-2,2':6',2''-terpyridine represents a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₆H₁₃N₃S

InChI: InChI=1/C16H13N3S/c1-20-12-10-15(13-6-2-4-8-17-13)19-16(11-12)14-7-3-5-9-18-14/h2-11H,1H3

SMILES: CSc1cc(c2ccccn2)nc(c1)c1ccccn1

Synonyms:

• 2,2':6',2''-Terpyridine, 4'-(Methylthio)-
• 4'-(Methylsulfanyl)-2,2':6',2''-terpyridin
• 4'-Methylthio-2,2':6',2''-terpyridine
• 78570-35-1
• 4'-(Méthylsulfanyl)-2,2':6',2''-terpyridine
• 4'-(Methylsulfanyl)-2,2':6',2''-terpyridine