CAS 785774-74-5
:5,6,7,8-tetrahydro-1,6-naphthyridin-3-ol
Description:
5,6,7,8-tetrahydro-1,6-naphthyridin-3-ol is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a saturated ring system with four hydrogen atoms added to the naphthyridine framework, resulting in a tetrahydro derivative. The presence of a hydroxyl (-OH) group at the 3-position contributes to its potential as a biologically active molecule, influencing its solubility and reactivity. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability, polarity, and ability to form hydrogen bonds are important characteristics that can affect its behavior in different chemical environments. Overall, 5,6,7,8-tetrahydro-1,6-naphthyridin-3-ol represents a class of compounds that may have significant implications in drug development and other chemical applications.
Formula:C8H10N2O
InChI:InChI=1/C8H10N2O/c11-7-3-6-4-9-2-1-8(6)10-5-7/h3,5,9,11H,1-2,4H2
SMILES:C1CNCc2cc(cnc12)O
Synonyms:- 1,6-Naphthyridin-3-ol, 5,6,7,8-tetrahydro-
- 5,6,7,8-tetrahydro-1,6-naphthyridin-3-ol hydrochloride
- 5,6,7,8-Tetrahydro-1,6-naphthyridin-3-ol
- 6-Boc-3-hydroxy-7,8-dihydro-5H-[1,6]naphthyridine
- 5,6,7,8-Tetrahydro-1,6phthyridin-3-ol
- 6-naphthyridin-3-ol hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
