CAS 785792-43-0

N-[(3-Bromophenyl)sulfonyl]-β-alanine

Description:

N-[(3-Bromophenyl)sulfonyl]-β-alanine is an organic compound characterized by the presence of a β-alanine backbone modified with a sulfonyl group attached to a 3-bromophenyl moiety. This compound features a sulfonamide functional group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The bromine atom on the phenyl ring introduces significant electronegativity, potentially influencing the compound's reactivity and interactions with biological targets. The presence of the sulfonyl group enhances the compound's solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. Additionally, the structural features of this compound may contribute to its biological activity, possibly serving as a scaffold for the design of inhibitors or modulators in therapeutic contexts. Overall, N-[(3-Bromophenyl)sulfonyl]-β-alanine exemplifies a class of compounds that combine aromatic and aliphatic characteristics, offering diverse chemical properties and potential applications in research and industry.

Formula: C₉H₁₀BrNO₄S

InChI: InChI=1S/C9H10BrNO4S/c10-7-2-1-3-8(6-7)16(14,15)11-5-4-9(12)13/h1-3,6,11H,4-5H2,(H,12,13)

InChI key: InChIKey=JBXKHAAFCMCAFR-UHFFFAOYSA-N

SMILES: S(NCCC(O)=O)(=O)(=O)C1=CC(Br)=CC=C1

Synonyms:

• N-[(3-Bromophenyl)sulfonyl]-β-alanine
• β-Alanine, N-[(3-bromophenyl)sulfonyl]-

3-(3-Bromobenzenesulfonamido)propanoic acid

CAS: 785792-43-0

Versatile small molecule scaffold

Formula: C₉H₁₀BrNO₄S

Purity: Min. 95%

Molecular weight: 308.15 g/mol

Ref: 3D-KGB79243