CAS 78582-17-9
:1-(2-deoxy-beta-D-erythro-pentofuranosyl)-1H-imidazo[4,5-c]pyridin-4-amine
Description:
1-(2-Deoxy-beta-D-erythro-pentofuranosyl)-1H-imidazo[4,5-c]pyridin-4-amine, with the CAS number 78582-17-9, is a chemical compound that features a unique structure combining a nucleoside-like moiety with an imidazo[4,5-c]pyridine core. This compound is characterized by its potential biological activity, particularly in the context of nucleoside analogs, which can influence nucleic acid metabolism. The presence of the deoxy-pentofuranosyl group suggests that it may interact with nucleic acids, potentially serving as an inhibitor or modulator in various biochemical pathways. The imidazo[4,5-c]pyridine structure contributes to its pharmacological properties, possibly enhancing its ability to bind to specific biological targets. Additionally, the compound may exhibit solubility in polar solvents, which is typical for similar nucleoside derivatives. Its synthesis and characterization are of interest in medicinal chemistry, particularly for developing antiviral or anticancer agents. Further studies would be necessary to elucidate its mechanism of action and therapeutic potential.
Formula:C11H14N4O3
InChI:InChI=1/C11H14N4O3/c12-11-10-6(1-2-13-11)15(5-14-10)9-3-7(17)8(4-16)18-9/h1-2,5,7-9,16-17H,3-4H2,(H2,12,13)/t7-,8+,9+/m0/s1
Synonyms:- 3-Deaza-2'-Deoxyadenosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2R,3S,5R)-5-(4-Amino-1H-imidazo[4,5-c]pyridin-1-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol
CAS:Formula:C11H14N4O3Color and Shape:SolidMolecular weight:250.25393-Deaza-2'-deoxyadenosine
CAS:3-Deaza-2'-deoxyadenosine inhibits lymphocyte cytolysis at 100 μM with low toxicity; aids in studying adenine N3 in DNA.Formula:C11H14N4O3Color and Shape:SolidMolecular weight:250.253-Deaza-2'-Deoxyadenosine
CAS:<p>3-Deaza-2'-Deoxyadenosine is a nucleoside analog that is synthesized from 2'-deoxyadenosine. It has been shown to be more potent than natural adenosine in inhibiting the activity of certain RNA polymerases. 3-Deaza-2'-Deoxyadenosine inhibits RNA synthesis by binding to the ribose moiety of the ribonucleotide, which prevents the formation of an enzyme-substrate complex and thus blocks chain elongation. This compound is also able to inhibit DNA synthesis by binding to the deoxyribose moiety of DNA and preventing DNA polymerase from adding nucleotides to the growing strand. 3-Deaza-2'-Deoxyadenosine has been shown to have antiviral activity against influenza virus and herpes simplex virus type 1 (HSV) in vitro.</p>Formula:C11H14N4O3Purity:Min. 95%Molecular weight:250.25 g/mol


