CAS 78584-09-5
:2-Benzothiazolamine,7-chloro-4-methyl-
Description:
2-Benzothiazolamine, 7-chloro-4-methyl- is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features an amino group (-NH2) at the 2-position of the benzothiazole, a chlorine atom at the 7-position, and a methyl group (-CH3) at the 4-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The chlorine atom introduces a halogen, which can enhance the compound's biological activity and influence its solubility and stability. The amino group can participate in hydrogen bonding, affecting the compound's interactions with other molecules. Overall, 2-Benzothiazolamine, 7-chloro-4-methyl- is notable for its unique structural features that may confer specific properties, making it of interest for further research and development in chemical synthesis and application.
Formula:C8H7ClN2S
InChI:InChI=1S/C8H7ClN2S/c1-4-2-3-5(9)7-6(4)11-8(10)12-7/h2-3H,1H3,(H2,10,11)
InChI key:InChIKey=KZDLRPCFYGSRNU-UHFFFAOYSA-N
SMILES:CC1=C2C(SC(N)=N2)=C(Cl)C=C1
Synonyms:- (7-Chloro-4-methylbenzothiazol-2-yl)amine
- 2-Amino-4-methyl-7-chlorobenzothiazole
- 2-Amino-7-chloro-4-methylbenzothiazole
- 7-Chloro-4-methyl-2-benzothiazolamine
- 2-Benzothiazolamine, 7-chloro-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
