CAS 78589-10-3

(4-chlorophenyl)-(2-methoxyphenyl)methanone

Description:

(4-chlorophenyl)-(2-methoxyphenyl)methanone, also known by its CAS number 78589-10-3, is an organic compound characterized by its ketone functional group, specifically a methanone structure where a phenyl group is substituted with a chlorine atom and another with a methoxy group. This compound typically appears as a solid or crystalline substance and is known for its aromatic properties due to the presence of two phenyl rings. The chlorine substituent can influence its reactivity and solubility, while the methoxy group may enhance its lipophilicity. It is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity. Safety data should be consulted, as it may pose health risks if not handled properly, including potential irritant effects.

Formula: C₁₄H₁₁ClO₂

InChI: InChI=1/C14H11ClO2/c1-17-13-5-3-2-4-12(13)14(16)10-6-8-11(15)9-7-10/h2-9H,1H3

SMILES: COc1ccccc1C(=O)c1ccc(cc1)Cl

(4-Chlorophenyl)(2-methoxyphenyl)methanone

CAS: 78589-10-3

Versatile small molecule scaffold

Formula: C₁₄H₁₁ClO₂

Purity: Min. 95%

Molecular weight: 246.69 g/mol

Ref: 3D-DDA58910