CAS 78589-11-4

(3-chlorophenyl)-(2-methoxyphenyl)methanone

Description:

(3-chlorophenyl)-(2-methoxyphenyl)methanone, with the CAS number 78589-11-4, is an organic compound characterized by its ketone functional group, specifically a methanone structure where a phenyl group is substituted with both a chlorine atom and a methoxy group. This compound exhibits properties typical of aromatic ketones, including a relatively high boiling point and moderate solubility in organic solvents due to its non-polar aromatic rings. The presence of the chlorine atom introduces electronegative characteristics, which can influence the compound's reactivity and polarity. The methoxy group, being an electron-donating substituent, can also affect the compound's electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₄H₁₁ClO₂

InChI: InChI=1/C14H11ClO2/c1-17-13-8-3-2-7-12(13)14(16)10-5-4-6-11(15)9-10/h2-9H,1H3

SMILES: COc1ccccc1C(=O)c1cccc(c1)Cl