CAS 78597-06-5
:(1E)-1-furan-2-ylethanone thiosemicarbazone
Description:
(1E)-1-furan-2-ylethanone thiosemicarbazone is an organic compound characterized by its thiosemicarbazone functional group, which is derived from the condensation of thiosemicarbazide with a ketone. This compound features a furan ring, a five-membered aromatic heterocycle containing oxygen, which contributes to its unique chemical properties. The presence of the thiosemicarbazone moiety imparts biological activity, often associated with potential antimicrobial and anticancer properties. The compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents. Its reactivity can be influenced by the presence of the furan ring, which can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Additionally, the compound may display tautomeric behavior, where it can exist in different structural forms, affecting its stability and reactivity. Overall, (1E)-1-furan-2-ylethanone thiosemicarbazone is of interest in medicinal chemistry and material science due to its diverse applications and biological significance.
Formula:C7H9N3OS
InChI:InChI=1/C7H9N3OS/c1-5(9-10-7(8)12)6-3-2-4-11-6/h2-4H,1H3,(H3,8,10,12)/b9-5+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.