CAS 78597-27-0

6-iodo-1H-benzimidazole

Description:

6-Iodo-1H-benzimidazole is a heterocyclic organic compound characterized by the presence of an iodine atom at the 6-position of the benzimidazole ring system. This compound features a fused bicyclic structure consisting of a benzene ring and an imidazole ring, which contributes to its aromatic properties and stability. The iodine substitution can influence the compound's reactivity, solubility, and biological activity, making it of interest in various fields, including medicinal chemistry and material science. Typically, benzimidazole derivatives exhibit a range of pharmacological activities, including antimicrobial, antifungal, and anticancer properties. The presence of the iodine atom may enhance these activities or alter the compound's interaction with biological targets. Additionally, 6-iodo-1H-benzimidazole may be utilized as an intermediate in organic synthesis or as a building block for the development of more complex molecules. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and solvents used.

Formula: C₇H₅IN₂

InChI: InChI=1/C7H5IN2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H,(H,9,10)

SMILES: c1cc2c(cc1I)[nH]cn2

Synonyms:

• 1H-benzimidazole, 5-iodo-
• 5-Iodo-1H-Benzimidazole

6-Iodo-1H-benzo[d]imidazole

CAS: 78597-27-0

Formula: C₇H₅IN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 244.0325

Ref: IN-DA0059GA

5-Iodo-1H-benzimidazole

CAS: 78597-27-0

5-Iodo-1H-benzimidazole

Formula: C₇H₅IN₂

Purity: 97%

Color and Shape: faint lemon powder

Molecular weight: 244.03g/mol

Ref: 54-OR16685

6-Iodo-1H-benzo[d]imidazole

CAS: 78597-27-0

Formula: C₇H₅IN₂

Purity: 97%

Color and Shape: Solid, White powder

Molecular weight: 244.035

Ref: 10-F234097

5-Iodo-1H-benzimidazole

CAS: 78597-27-0

5-Iodo-1H-benzimidazole is a chemical compound that can be recycled. It is used in medicinal chemistry and organic chemistry, but has not been extensively studied. This compound is used as a precursor to other structures, such as 5-iodo-N-methylbenzamide. The reaction of 5-iodo-1H benzimidazole with zinc powder produces a high yield of the desired product.
5-Iodo benzimidazole can be used as an electron donor in reductive reactions, such as the synthesis of nitroarenes. In addition to its use in organic chemistry, this compound has shown potential for biomolecular applications.

Formula: C₇H₅IN₂

Purity: Min. 95%

Molecular weight: 244.03 g/mol

Ref: 3D-DDA59727