CymitQuimica logo

CAS 78600-31-4

:

2-Bromotriphenylamine

Description:
2-Bromotriphenylamine is an organic compound characterized by its structure, which includes a triphenylamine core substituted with a bromine atom at the second position. This compound typically appears as a solid and is known for its potential applications in organic electronics, particularly in the development of organic light-emitting diodes (OLEDs) and organic photovoltaics. The presence of the bromine atom enhances its electronic properties, making it a useful material in various chemical reactions, including cross-coupling reactions. 2-Bromotriphenylamine exhibits moderate solubility in organic solvents, which is advantageous for processing in various applications. Additionally, it may display interesting photophysical properties, such as fluorescence, which can be influenced by its molecular structure and environment. As with many brominated compounds, it is essential to handle 2-Bromotriphenylamine with care due to potential toxicity and environmental concerns associated with brominated organic compounds. Proper safety measures should be taken when working with this substance in a laboratory setting.
Formula:C18H14BrN
InChI:InChI=1S/C18H14BrN/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H
InChI key:YPIANBZIVBPMJS-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3Br
Synonyms:
  • Benzenamine, 2-bromo-N,N-diphenyl-
Found 5 products.