CAS 78600-33-6

3-Bromo-N,N-Diphenylaniline

Description:

3-Bromo-N,N-Diphenylaniline is an organic compound characterized by its structure, which includes a bromine atom attached to a diphenylamine moiety. This compound features a central aniline structure with two phenyl groups (C6H5) attached to the nitrogen atom, along with a bromine substituent at the meta position relative to the nitrogen. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific formulation. The presence of the bromine atom can influence its reactivity, making it useful in various chemical syntheses, particularly in the field of organic electronics and dye chemistry. Additionally, 3-Bromo-N,N-Diphenylaniline may exhibit properties such as moderate solubility in organic solvents and potential applications in the development of organic semiconductors or as a precursor in the synthesis of other complex organic molecules. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts.

Formula: C₁₈H₁₄BrN

InChI: InChI=1/C18H14BrN/c19-15-8-7-13-18(14-15)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H

SMILES: c1ccc(cc1)N(c1ccccc1)c1cccc(c1)Br

Synonyms:

• 3-Bromotriphenylamine

3-Bromotriphenylamine

CAS: 78600-33-6

Formula: C₁₈H₁₄BrN

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 324.22

Ref: 3B-B4036

Benzenamine, 3-​bromo-​N,​N-​diphenyl-

CAS: 78600-33-6

Formula: C₁₈H₁₄BrN

Purity: 97%

Color and Shape: Solid

Molecular weight: 324.2145

Ref: IN-DA003J4P

3-Bromo-N,N-diphenylaniline

CAS: 78600-33-6

3-Bromo-N,N-diphenylaniline

Purity: 99%

Molecular weight: 324.22g/mol

Ref: 54-OR75005

3-Bromo-N,N-diphenylaniline

CAS: 78600-33-6

Purity: 99.0%

Color and Shape: Solid

Molecular weight: 324.22100830078125

Ref: 10-F546211