
CAS 78601-00-0
:1-[2-[2-[2-(Dodecyloxy)ethoxy]ethoxy]ethyl] (2Z)-2-butenedioate
Description:
1-[2-[2-[2-(Dodecyloxy)ethoxy]ethoxy]ethyl] (2Z)-2-butenedioate, identified by CAS number 78601-00-0, is a chemical compound characterized by its complex structure, which includes a long hydrophobic dodecyloxy chain and a hydrophilic ethylene glycol ether segment. This amphiphilic nature allows it to exhibit surfactant properties, making it useful in various applications, including emulsification and solubilization in formulations. The presence of the (2Z)-2-butenedioate moiety suggests potential reactivity, particularly in polymerization or cross-linking reactions. The compound's hydrophobic tail contributes to its ability to interact with lipid membranes, while the hydrophilic head enhances solubility in aqueous environments. Such characteristics make it valuable in fields like pharmaceuticals, cosmetics, and materials science, where it can function as a stabilizer or dispersant. Additionally, its unique structure may influence its biological activity and compatibility with other substances, warranting further investigation for specific applications.
Formula:C22H40O7
InChI:InChI=1S/C22H40O7/c1-2-3-4-5-6-7-8-9-10-11-14-26-15-16-27-17-18-28-19-20-29-22(25)13-12-21(23)24/h12-13H,2-11,14-20H2,1H3,(H,23,24)/b13-12-
InChI key:InChIKey=LSDNCMFQVGKKGP-SEYXRHQNSA-N
SMILES:C(COCCOCCOCCCCCCCCCCCC)OC(/C=C\C(O)=O)=O
Synonyms:- 1-[2-[2-[2-(Dodecyloxy)ethoxy]ethoxy]ethyl] (2Z)-2-butenedioate
- 2-Butenedioic acid (2Z)-, mono[2-[2-[2-(dodecyloxy)ethoxy]ethoxy]ethyl] ester
- 2-Butenedioic acid (Z)-, mono[2-[2-[2-(dodecyloxy)ethoxy]ethoxy]ethyl] ester
- 2-Butenedioic acid (2Z)-, 1-[2-[2-[2-(dodecyloxy)ethoxy]ethoxy]ethyl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(E)-4-[2-[2-(2-dodecoxyethoxy)ethoxy]ethoxy]-4-oxo-but-2-enoic acid
CAS:Formula:C22H40O7Molecular weight:416.5488

