CymitQuimica logo

CAS 78603-93-7

:

(R)-(+)-2-Amino-1,1-diphenyl-1-propanol

Description:
(R)-(+)-2-Amino-1,1-diphenyl-1-propanol, with the CAS number 78603-93-7, is an organic compound characterized by its chiral structure, which includes an amino group and two phenyl groups attached to a propanol backbone. This compound is typically a white to off-white solid and is known for its role as a chiral auxiliary in asymmetric synthesis, particularly in the production of pharmaceuticals. Its stereochemistry allows it to interact selectively with other chiral molecules, making it valuable in enantioselective reactions. The presence of the amino group contributes to its basicity and potential for hydrogen bonding, influencing its solubility and reactivity in various solvents. Additionally, the diphenyl structure enhances its stability and can affect its physical properties, such as melting point and boiling point. Overall, (R)-(+)-2-Amino-1,1-diphenyl-1-propanol is significant in synthetic organic chemistry, particularly in the development of chiral drugs and compounds.
Formula:C15H17NO
InChI:InChI=1/C15H17NO/c1-12(16)15(17,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,17H,16H2,1H3/t12-/m1/s1
InChI key:FMBMNSFOFOAIMZ-GFCCVEGCSA-N
SMILES:C[C@H](C(c1ccccc1)(c1ccccc1)O)N
Synonyms:
  • (2R)-2-amino-1,1-diphenylpropan-1-ol
  • (R)-2-Amino-1,1-diphenyl-1-propanol
  • (R)-2-AMINO-1,2-DIPHENYL-1-PROPANOL
Found 3 products.