CAS 78605-10-4
:6-phenyl-5H-pyrrolo[2,3-b]pyrazine
Description:
6-Phenyl-5H-pyrrolo[2,3-b]pyrazine is a heterocyclic organic compound characterized by its fused pyrrole and pyrazine rings, which contribute to its unique chemical properties. This compound features a phenyl group attached to the pyrrole moiety, enhancing its aromatic character and potentially influencing its reactivity and solubility. The structure of 6-phenyl-5H-pyrrolo[2,3-b]pyrazine suggests it may exhibit interesting electronic properties, making it a candidate for applications in organic electronics or as a building block in medicinal chemistry. Its heterocyclic nature may also impart biological activity, which could be explored in drug development. The compound is typically synthesized through multi-step organic reactions, and its stability and reactivity can be influenced by the substituents on the aromatic ring. As with many heterocycles, it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, depending on the reaction conditions. Overall, 6-phenyl-5H-pyrrolo[2,3-b]pyrazine represents a versatile structure in organic synthesis and materials science.
Formula:C12H9N3
InChI:InChI=1/C12H9N3/c1-2-4-9(5-3-1)10-8-11-12(15-10)14-7-6-13-11/h1-8H,(H,14,15)
SMILES:c1ccc(cc1)c1cc2c([nH]ccn2)n1
Synonyms:- 5H-pyrrolo[2,3-b]pyrazine, 6-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
