CAS 78633-42-8
:2,3-Dihydro-3-methyl-2-oxo-5-benzoxazolesulfonyl chloride
Description:
2,3-Dihydro-3-methyl-2-oxo-5-benzoxazolesulfonyl chloride, with the CAS number 78633-42-8, is a chemical compound characterized by its unique structure that includes a benzoxazole ring, a sulfonyl chloride functional group, and a ketone moiety. This compound typically appears as a solid or crystalline substance and is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a sulfonylating agent. The compound may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during use. Additionally, it is important to consider its stability under various conditions, as well as its solubility in organic solvents, which can influence its application in synthetic processes. Overall, 2,3-Dihydro-3-methyl-2-oxo-5-benzoxazolesulfonyl chloride is a valuable intermediate in chemical synthesis.
Formula:C8H6ClNO4S
InChI:InChI=1S/C8H6ClNO4S/c1-10-6-4-5(15(9,12)13)2-3-7(6)14-8(10)11/h2-4H,1H3
InChI key:InChIKey=VOVZUAYMQLWUCT-UHFFFAOYSA-N
SMILES:CN1C=2C(OC1=O)=CC=C(S(Cl)(=O)=O)C2
Synonyms:- 2,3-Dihydro-3-methyl-2-oxo-5-benzoxazolesulfonyl chloride
- 3-Methyl-2-oxo-1,3-benzoxazole-5-sulfonyl chloride
- 5-Benzoxazolesulfonyl chloride, 2,3-dihydro-3-methyl-2-oxo-
- 3-Methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-5-sulfonyl chloride
- 3-methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-5-sulfonyl chloride(SALTDATA: FREE)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.