CAS 78647-31-1

ethyl 4-oxotetrahydrothiophene-3-carboxylate

Description:

Ethyl 4-oxotetrahydrothiophene-3-carboxylate is a chemical compound characterized by its unique structure, which includes a tetrahydrothiophene ring and a carboxylate functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the carbonyl group (4-oxo) contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Additionally, the ethyl ester group enhances its solubility in organic solvents, making it useful in various chemical processes. Safety data sheets indicate that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, ethyl 4-oxotetrahydrothiophene-3-carboxylate is a versatile compound with significant relevance in synthetic organic chemistry.

Formula: C₇H₁₀O₃S

InChI: InChI=1/C7H10O3S/c1-2-10-7(9)5-3-11-4-6(5)8/h5H,2-4H2,1H3

SMILES: CCOC(=O)C1CSCC1=O

Ethyl 4-oxotetrahydrothiophene-3-carboxylate

CAS: 78647-31-1

Formula: C₇H₁₀O₃S

Purity: 98%

Color and Shape: Liquid

Molecular weight: 174.2175

Ref: IN-DA0058SF

Ethyl 4-oxotetrahydrothiophene-3-carboxylate

CAS: 78647-31-1

Ethyl 4-oxotetrahydrothiophene-3-carboxylate

Purity: 98%

Molecular weight: 174.22g/mol

Ref: 54-OR933089

Ethyl 4-oxotetrahydrothiophene-3-carboxylate

CAS: 78647-31-1

Formula: C₇H₁₀O₃S

Purity: 98%

Color and Shape: Liquid

Molecular weight: 174.21

Ref: 10-F209648

Ethyl 4-oxotetrahydrothiophene-3-carboxylate

CAS: 78647-31-1

Ethyl 4-oxotetrahydrothiophene-3-carboxylate is a synthetic compound that can be prepared by the reaction of ethoxycarbonylethyl thioglycolate with diethyl sulfide. It is an acrylate, which can be used to make polynuclear compounds. The target compound is an ethyl ester, which can be obtained by adding ethylene glycol and sulfuric acid to the adduct of methyl thioglycolate and toluene. Ethyl 4-oxotetrahydrothiophene-3-carboxylate has been shown to react with thioglycolic acid in a workup procedure, producing the desired product.

Formula: C₇H₁₀O₃S

Purity: Min. 95%

Molecular weight: 174.21 g/mol

Ref: 3D-DDA64731