CymitQuimica logo

CAS 78650-08-5

:

1,4-Dihydro-4-(2-thienyl)-1,3,5-triazino[1,2-a]benzimidazol-2-amine

Description:
1,4-Dihydro-4-(2-thienyl)-1,3,5-triazino[1,2-a]benzimidazol-2-amine is a heterocyclic compound characterized by its complex structure, which includes a triazine ring fused to a benzimidazole moiety. This compound features a thienyl substituent, contributing to its unique chemical properties. It typically exhibits moderate to high solubility in polar organic solvents, which is influenced by the presence of nitrogen and sulfur atoms in its structure. The compound may display biological activity, making it of interest in medicinal chemistry, particularly for its potential pharmacological applications. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the presence of reactive functional groups. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, 1,4-Dihydro-4-(2-thienyl)-1,3,5-triazino[1,2-a]benzimidazol-2-amine represents a class of compounds that may have significant implications in drug development and materials science.
Formula:C13H11N5S
InChI:InChI=1S/C13H11N5S/c14-12-16-11(10-6-3-7-19-10)18-9-5-2-1-4-8(9)15-13(18)17-12/h1-7,11H,(H3,14,15,16,17)
InChI key:InChIKey=MKXLYVVEBIMPSW-UHFFFAOYSA-N
SMILES:NC1=NC(N2C=3C(NC2=N1)=CC=CC3)C4=CC=CS4
Synonyms:
  • 1,3,5-Triazino[1,2-a]benzimidazol-2-amine, 1,4-dihydro-4-(2-thienyl)-
  • 1,4-Dihydro-4-(2-thienyl)-1,3,5-triazino[1,2-a]benzimidazol-2-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.