CAS 78658-51-2

L-Glutamic acid, N-L-γ-glutamyl-, 1,1′-bis(phenylmethyl) ester

Description:

L-Glutamic acid, N-L-γ-glutamyl-, 1,1′-bis(phenylmethyl) ester, identified by the CAS number 78658-51-2, is a chemical compound that belongs to the class of amino acid derivatives. This substance is characterized by its structure, which includes a glutamic acid moiety modified with a γ-glutamyl group and two phenylmethyl ester groups. The presence of the phenylmethyl groups contributes to its lipophilicity, potentially affecting its solubility and biological activity. L-Glutamic acid itself is a non-essential amino acid that plays a crucial role in cellular metabolism and neurotransmission. The modification of glutamic acid in this compound may influence its reactivity and interactions with biological systems. Typically, such compounds are studied for their potential applications in pharmaceuticals, biochemistry, and as biochemical probes. The specific properties, such as melting point, solubility, and reactivity, would depend on the compound's detailed structure and the conditions under which it is studied.

Formula: C₂₄H₂₈N₂O₇

InChI: InChI=1S/C24H28N2O7/c25-19(23(30)32-15-17-7-3-1-4-8-17)11-13-21(27)26-20(12-14-22(28)29)24(31)33-16-18-9-5-2-6-10-18/h1-10,19-20H,11-16,25H2,(H,26,27)(H,28,29)/t19-,20-/m0/s1

InChI key: InChIKey=UAYGUMNJBPYDOX-PMACEKPBSA-N

SMILES: [C@H](C(OCC1=CC=CC=C1)=O)(NC(CC[C@@H](C(OCC2=CC=CC=C2)=O)N)=O)CCC(O)=O

Synonyms:

• L-Glutamic acid, N-L-γ-glutamyl-, 1,1′-bis(phenylmethyl) ester