CAS 786652-63-9

2-(3-bromo-2-fluoro-phenyl)acetic acid

Description:

2-(3-bromo-2-fluoro-phenyl)acetic acid is an organic compound characterized by its aromatic structure and the presence of both bromine and fluorine substituents on the phenyl ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The bromine and fluorine atoms introduce unique electronic effects, influencing the compound's reactivity and potential interactions in chemical reactions. Typically, such halogenated compounds exhibit increased lipophilicity, which can affect their solubility in organic solvents and biological systems. The presence of these halogens may also enhance the compound's stability and alter its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the specific arrangement of substituents can lead to distinct stereochemical configurations, impacting the compound's biological activity. Overall, 2-(3-bromo-2-fluoro-phenyl)acetic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals, due to its unique structural characteristics.

Formula: C₈H₆BrFO₂

InChI: InChI=1/C8H6BrFO2/c9-6-3-1-2-5(8(6)10)4-7(11)12/h1-3H,4H2,(H,11,12)

SMILES: c1cc(CC(=O)O)c(c(c1)Br)F

Synonyms:

• (3-Bromo-2-fluorophenyl)acetic acid
• Benzeneacetic Acid, 3-Bromo-2-Fluoro-

(3-Bromo-2-Fluoro-Phenyl)-Acetic Acid

CAS: 786652-63-9

(3-Bromo-2-Fluoro-Phenyl)-Acetic Acid

Purity: 98%+(LC-MS);RG

Molecular weight: 233.03g/mol

Ref: 54-PC109139