CAS 78668-42-5
:1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetic acid, hydrochloride (1:4)
Description:
1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetic acid, hydrochloride (1:4), commonly referred to as a tetraazamacrocyclic ligand, is a complex organic compound characterized by its cyclic structure containing four nitrogen atoms and multiple acetic acid functional groups. This compound is typically used in coordination chemistry and biochemistry due to its ability to form stable complexes with metal ions, which can be beneficial in various applications, including drug delivery and imaging. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water. The tetraacetic acid moieties contribute to its chelating properties, allowing it to effectively bind to metal ions. This compound is often studied for its potential in medical applications, particularly in the development of contrast agents for magnetic resonance imaging (MRI) and as a therapeutic agent in targeted drug delivery systems. Its stability, solubility, and ability to form complexes make it a valuable substance in both research and industrial applications.
Formula:C18H32N4O8·4ClH
InChI:InChI=1S/C18H32N4O8.4ClH/c23-15(24)11-19-3-1-4-20(12-16(25)26)8-10-22(14-18(29)30)6-2-5-21(9-7-19)13-17(27)28;;;;/h1-14H2,(H,23,24)(H,25,26)(H,27,28)(H,29,30);4*1H
InChI key:InChIKey=MRVXRWYEUOKGHI-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1CCN(CC(O)=O)CCCN(CC(O)=O)CCN(CC(O)=O)CCC1.Cl
Synonyms:- 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetic acid tetrahydrochloride tetrahydrate
- 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetic acid, hydrochloride (1:4)
- 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetic acid, tetrahydrochloride
- 2,2',2'',2'''-(1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-Tetrayl)Tetraacetic Acid Tetrahydrochloride Hydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetic Acid Hydrochloride
CAS:Controlled ProductFormula:C18H36Cl4N4O8Color and Shape:NeatMolecular weight:460.536
