CAS 78676-34-3
:1-benzothiophene-3-carbohydrazide
Description:
1-Benzothiophene-3-carbohydrazide is an organic compound characterized by its unique structure, which includes a benzothiophene moiety and a carbohydrazide functional group. This compound typically exhibits a solid state at room temperature and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the thiophene ring contributes to its aromatic characteristics, while the carbohydrazide group can participate in various chemical reactions, making it a versatile building block in organic synthesis. Its solubility can vary depending on the solvent used, and it may display distinct spectral properties in techniques such as UV-Vis and NMR spectroscopy. Additionally, 1-benzothiophene-3-carbohydrazide may undergo various chemical transformations, including hydrazone formation and coupling reactions, which are of interest in medicinal chemistry and materials science. Overall, this compound represents a significant interest in research due to its potential applications in pharmaceuticals and organic materials.
Formula:C9H8N2OS
InChI:InChI=1/C9H8N2OS/c10-11-9(12)7-5-13-8-4-2-1-3-6(7)8/h1-5H,10H2,(H,11,12)
SMILES:c1ccc2c(c1)c(cs2)C(=NN)O
Synonyms:- Benzo[B]Thiophene-3-Carboxylic Acid, Hydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Benzothiophene-3-carbohydrazide
CAS:1-Benzothiophene-3-carbohydrazide (1BZC) is a small molecule that inhibits the growth of cancer cells. It acts by inhibiting the protein kinase pim-1, which is necessary for many cellular processes, including cell proliferation and cell adhesion. 1BZC has been shown to inhibit tumor growth in vivo, as well as in vitro in cancer cell lines and mouse xenografts. The drug has also been shown to disrupt tumor vascularization by targeting the protein vegfr-2. 1BZC has also been shown to be effective against two different human cancers: MDA-MB231 breast cancer cells and MKN45 gastric cancer cells. The drug has anti-proliferative activity against both cell lines and inhibits the growth of MDA-MB231 cells more than MKN45 cells.Formula:C9H8N2OSPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:192.24 g/mol

