CAS 78682-09-4

1-[4-(Difluoromethoxy)phenyl]-2-methyl-1-propanone

Description:

1-[4-(Difluoromethoxy)phenyl]-2-methyl-1-propanone, with the CAS number 78682-09-4, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. This compound features a difluoromethoxy group attached to a phenyl ring, which contributes to its unique chemical properties, including potential reactivity and polarity. The presence of the methyl group on the propanone backbone enhances its steric profile and may influence its solubility and interaction with other molecules. Typically, such compounds are of interest in various fields, including pharmaceuticals and agrochemicals, due to their potential biological activity. The difluoromethoxy substituent can affect the electronic distribution within the molecule, potentially enhancing its lipophilicity and altering its pharmacokinetic properties. As with many organic compounds, its stability, reactivity, and behavior in different environments can be influenced by factors such as temperature, pH, and the presence of other chemical species. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with exposure.

Formula: C₁₁H₁₂F₂O₂

InChI: InChI=1S/C11H12F2O2/c1-7(2)10(14)8-3-5-9(6-4-8)15-11(12)13/h3-7,11H,1-2H3

InChI key: InChIKey=FCBDKBWPEKKACE-UHFFFAOYSA-N

SMILES: C(C(C)C)(=O)C1=CC=C(OC(F)F)C=C1

Synonyms:

• 1-Propanone, 1-[4-(difluoromethoxy)phenyl]-2-methyl-
• 1-[4-(Difluoromethoxy)phenyl]-2-methyl-1-propanone
• 1-(4-(Difluoromethoxy)phenyl)-2-methylpropan-1-one