CymitQuimica logo

CAS 78686-02-9

:

2-chloro-N-ethyl-N-(2-methylbenzyl)ethanamine

Description:
2-Chloro-N-ethyl-N-(2-methylbenzyl)ethanamine is a chemical compound characterized by its amine functional group, which includes a chloro substituent and an ethyl group attached to the nitrogen atom. This compound features a 2-methylbenzyl group, indicating the presence of a benzene ring with a methyl group at the second position, contributing to its hydrophobic characteristics. The presence of the chlorine atom introduces additional reactivity and can influence the compound's solubility and interaction with biological systems. Typically, such amines can exhibit basic properties due to the lone pair of electrons on the nitrogen atom, allowing them to participate in protonation reactions. The compound's structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis, although specific applications would depend on further research into its biological activity and reactivity. Safety and handling considerations are essential, as with many amines, due to potential toxicity and reactivity with other chemicals.
Formula:C12H18ClN
InChI:InChI=1/C12H18ClN/c1-3-14(9-8-13)10-12-7-5-4-6-11(12)2/h4-7H,3,8-10H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.