CAS 78686-77-8
:Methyl 5-bromo-6-chloropyridine-3-carboxylate
Description:
Methyl 5-bromo-6-chloropyridine-3-carboxylate is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 5 and 6 positions with bromine and chlorine atoms, respectively. The presence of the carboxylate group, specifically as a methyl ester, contributes to its reactivity and solubility properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in medicinal chemistry and as an intermediate in organic synthesis. The halogen substituents enhance its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's structure allows for diverse functionalization, which is valuable in the development of pharmaceuticals and agrochemicals. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns. Overall, Methyl 5-bromo-6-chloropyridine-3-carboxylate is a significant compound in synthetic organic chemistry with various applications.
Formula:C7H5BrClNO2
InChI:InChI=1/C7H5BrClNO2/c1-12-7(11)4-2-5(8)6(9)10-3-4/h2-3H,1H3
SMILES:COC(=O)c1cc(c(Cl)nc1)Br
Synonyms:- Methyl 5-bromo-6-chloronicotinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 5-bromo-6-chloronicotinate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BrClNO2Purity:98%Molecular weight:250.48Methyl 5-bromo-6-chloronicotinate
CAS:Formula:C7H5BrClNO2Purity:98%Color and Shape:SolidMolecular weight:250.4771Methyl 5-bromo-6-chloronicotinate
CAS:Methyl 5-bromo-6-chloronicotinateFormula:C7H5BrClNO2Purity:≥95%Color and Shape: white crystalline solidMolecular weight:250.48g/molMethyl 5-Bromo-6-chloronicotinate
CAS:Formula:C7H5BrClNO2Purity:97%Color and Shape:SolidMolecular weight:250.48




