CAS 78686-79-0
:Methyl 5-bromo-2-chloronicotinate
Description:
Methyl 5-bromo-2-chloronicotinate is an organic compound that belongs to the class of nicotinic acid derivatives. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of both bromine and chlorine substituents on the aromatic ring contributes to its unique reactivity and potential applications in various chemical reactions. This compound is typically characterized by its moderate solubility in organic solvents, which is common for halogenated aromatic compounds. Methyl 5-bromo-2-chloronicotinate can be utilized in medicinal chemistry and as an intermediate in the synthesis of other complex organic molecules. Its structure allows for potential interactions in biological systems, making it of interest in pharmaceutical research. Additionally, the presence of halogen atoms can enhance its electrophilic properties, facilitating further chemical transformations. Safety precautions should be observed when handling this compound, as halogenated organic substances can pose health risks.
Formula:C7H5BrClNO2
InChI:InChI=1S/C7H5BrClNO2/c1-12-7(11)5-2-4(8)3-10-6(5)9/h2-3H,1H3
InChI key:InChIKey=MOMQDEDQGJAKII-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(Cl)N=CC(Br)=C1
Synonyms:- 3-Pyridinecarboxylic acid, 5-bromo-2-chloro-, methyl ester
- 5-Bromo-2-chloronicotinic acid methyl ester
- 5-Bromo-2-chloropyridine-3-carboxylic acid methyl ester
- Methyl 2-chloro-5-bromo-3-pyridinecarboxylate
- Methyl 5-bromo-2-chloronicotinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 5-Bromo-2-chloronicotinate
CAS:Formula:C7H5BrClNO2Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:250.48Methyl 5-bromo-2-chloronicotinate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BrClNO2Purity:98%Molecular weight:250.48Methyl 5-bromo-2-chloronicotinate
CAS:Formula:C7H5BrClNO2Purity:97%Color and Shape:SolidMolecular weight:250.4771Methyl 5-bromo-2-chloronicotinate
CAS:Methyl 5-bromo-2-chloronicotinateFormula:C7H5BrClNO2Purity:98%Color and Shape: yellow solidMolecular weight:250.48g/molMethyl 5-Bromo-2-chloronicotinate
CAS:Formula:C7H5BrClNO2Purity:97%Color and Shape:SolidMolecular weight:250.48




