CAS 78686-83-6
:methyl 2-chloro-5-iodopyridine-3-carboxylate
Description:
Methyl 2-chloro-5-iodopyridine-3-carboxylate is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2-position with a chlorine atom and at the 5-position with an iodine atom. The compound also features a carboxylate group at the 3-position, which is esterified with a methyl group. This structure imparts a range of chemical properties, including potential reactivity due to the presence of halogen substituents, which can participate in nucleophilic substitution reactions. The compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, owing to its ability to serve as an intermediate in various chemical reactions. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, methyl 2-chloro-5-iodopyridine-3-carboxylate is a valuable compound in synthetic organic chemistry.
Formula:C7H5ClINO2
InChI:InChI=1/C7H5ClINO2/c1-12-7(11)5-2-4(9)3-10-6(5)8/h2-3H,1H3
SMILES:COC(=O)c1cc(cnc1Cl)I
Synonyms:- 3-Pyridinecarboxylic Acid, 2-Chloro-5-Iodo-, Methyl Ester
- Methyl 2-chloro-5-iodonicotinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 2-chloro-5-iodonicotinate
CAS:Formula:C7H5ClINO2Purity:95%Color and Shape:SolidMolecular weight:297.4776Methyl 2-chloro-5-iodopyridine-3-carboxylate
CAS:Methyl 2-chloro-5-iodopyridine-3-carboxylatePurity:97%Molecular weight:297.48g/molMethyl 2-Chloro-5-iodonicotinate
CAS:Formula:C7H5ClINO2Purity:95%Color and Shape:SolidMolecular weight:297.48Methyl 2-chloro-5-iodonicotinate
CAS:<p>Methyl 2-chloro-5-iodonicotinate is a basic and yields a radioligand for use in imaging studies. It is used as a specific activity and solid-phase extraction. Methyl 2-chloro-5-iodonicotinate has been shown to be effective for radiolabeling studies of the brain following intravenous administration.</p>Formula:C7H5ClINO2Purity:Min. 95%Molecular weight:297.48 g/mol




