
CAS 78693-94-4
:Soyasaponin A1
Description:
Soyasaponin A1 is a triterpenoid saponin derived from soybeans, specifically from the Glycine max species. It is characterized by its complex structure, which includes a hydrophobic aglycone and a hydrophilic sugar moiety, contributing to its amphiphilic nature. This compound exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in both nutritional and pharmaceutical research. Soyasaponin A1 is known to interact with cell membranes, influencing membrane permeability and potentially modulating cellular signaling pathways. Additionally, it has been studied for its role in enhancing the bioavailability of certain nutrients and its potential effects on gut health. The compound is typically found in soy products and is often investigated for its health benefits, particularly in relation to cardiovascular health and metabolic disorders. Its safety profile is generally considered favorable, but further research is necessary to fully understand its mechanisms of action and therapeutic potential.
Formula:C59H96O29
InChI:InChI=1S/C59H96O29/c1-54(2)16-23-22-8-9-29-56(4)12-11-30(83-53-45(38(72)37(71)43(85-53)48(77)78)87-52-44(36(70)33(67)27(19-62)82-52)86-51-40(74)35(69)32(66)26(18-61)81-51)57(5,21-63)28(56)10-13-59(29,7)58(22,6)15-14-55(23,3)47(46(54)76)88-49-41(75)42(24(64)20-79-49)84-50-39(73)34(68)31(65)25(17-60)80-50/h8,23-47,49-53,60-76H,9-21H2,1-7H3,(H,77,78)/t23-,24-,25+,26+,27+,28+,29+,30-,31+,32+,33-,34-,35-,36-,37-,38-,39+,40+,41+,42-,43-,44+,45+,46-,47+,49-,50-,51-,52-,53+,55+,56-,57+,58+,59+/m0/s1
InChI key:InChIKey=XFXHYKZIZSNVSQ-TZRAUYBZSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C)(CC3)[C@H](O[C@H]5[C@H](O)[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@@H](O)CO5)[C@H](O)C(C)(C)C4)[H])=CC[C@@]1([C@]7(C)[C@@](CC2)([C@](CO)(C)[C@@H](O[C@H]8[C@H](O[C@H]9[C@H](O[C@@H]%10O[C@H](CO)[C@@H](O)[C@H](O)[C@H]%10O)[C@@H](O)[C@@H](O)[C@@H](CO)O9)[C@@H](O)[C@H](O)[C@@H](C(O)=O)O8)CC7)[H])[H]
Synonyms:- Soyasaponin A1
- Soysaponin A1
- β-D-Glucopyranosiduronic acid, (3β,4β,21β,22β)-22-[(3-O-β-D-glucopyranosyl-α-L-arabinopyranosyl)oxy]-21,23-dihydroxyolean-12-en-3-yl O-β-D-glucopyranosyl-(1→2)-O-β-D-galactopyranosyl-(1→2)-
- (3β,4β,21β,22β)-22-[(3-O-β-D-Glucopyranosyl-α-L-arabinopyranosyl)oxy]-21,23-dihydroxyolean-12-en-3-yl O-β-D-glucopyranosyl-(1→2)-O-β-D-galactopyranosyl-(1→2)-β-D-glucopyranosiduronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Soyasaponin A1
CAS:Soyasaponin A1 is a useful organic compound for research related to life sciences. The catalog number is T124217 and the CAS number is 78693-94-4.Formula:C59H96O29Color and Shape:SolidMolecular weight:1269.39
