CAS 78697-24-2

Benzenemethanaminium, 4-benzoyl-N,N,N-trimethyl-, bromide

Description:

Benzenemethanaminium, 4-benzoyl-N,N,N-trimethyl-, bromide, commonly referred to as a quaternary ammonium compound, exhibits several notable characteristics. This compound features a benzyl group attached to a nitrogen atom that is further substituted with three methyl groups and a benzoyl moiety, contributing to its unique chemical properties. As a quaternary ammonium salt, it is typically soluble in polar solvents, such as water and alcohols, due to its ionic nature. The presence of the bromide ion indicates that it can participate in ionic interactions, which may influence its reactivity and stability. This compound may exhibit antimicrobial properties, making it of interest in various applications, including pharmaceuticals and disinfectants. Additionally, its structure suggests potential uses in organic synthesis and as a phase transfer catalyst. However, handling should be approached with caution due to the potential toxicity associated with quaternary ammonium compounds. Overall, its unique structural features and properties make it a subject of interest in both industrial and research settings.

Formula: C₁₇H₂₀NO·Br

InChI: InChI=1S/C17H20NO.BrH/c1-18(2,3)13-14-9-11-16(12-10-14)17(19)15-7-5-4-6-8-15;/h4-12H,13H2,1-3H3;1H/q+1;/p-1

InChI key: InChIKey=YUCAMIGWPNXBJP-UHFFFAOYSA-M

SMILES: C(=O)(C1=CC=C(C[N+](C)(C)C)C=C1)C2=CC=CC=C2.[Br-]

Synonyms:

• Benzenemethanaminium, 4-benzoyl-N,N,N-trimethyl-, bromide
• p-(Benzoyl)benzyl-N,N,N-trimethylammonium bromide
• (4-Benzoylbenzyl)trimethylammonium bromide