
CAS 78697-56-0
:(1R,2S,4S,10R,12R,14R,15R)-2-(Acetyloxy)-12-methyl-4-(1-methylethenyl)-17-oxo-11,16,18,19-tetraoxapentacyclo[12.2.2.16,9.01,15.010,12]nonadeca-6,8-diene-7-carboxaldehyde
Description:
The chemical substance with the name "(1R,2S,4S,10R,12R,14R,15R)-2-(Acetyloxy)-12-methyl-4-(1-methylethenyl)-17-oxo-11,16,18,19-tetraoxapentacyclo[12.2.2.16,9.01,15.010,12]nonadeca-6,8-diene-7-carboxaldehyde" and CAS number "78697-56-0" is a complex organic compound characterized by its intricate polycyclic structure and multiple functional groups. It features a tetraoxapentacyclic framework, which contributes to its unique three-dimensional conformation and potential biological activity. The presence of an acetyloxy group and a carboxaldehyde moiety suggests reactivity that could be exploited in synthetic applications or biological interactions. Additionally, the stereochemistry indicated by the specific R and S configurations at various chiral centers implies that the compound may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Its structural complexity and functional diversity make it a subject of interest in fields such as medicinal chemistry and natural product synthesis. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C22H24O8
InChI:InChI=1S/C22H24O8/c1-10(2)12-5-14-13(9-23)6-15(27-14)18-21(4,29-18)8-16-19-22(30-19,20(25)28-16)17(7-12)26-11(3)24/h6,9,12,16-19H,1,5,7-8H2,2-4H3/t12-,16-,17+,18+,19-,21-,22-/m1/s1
InChI key:InChIKey=KGRIGHVGXOOCOY-ALYDTWDZSA-N
SMILES:O(C(C)=O)[C@@H]1[C@]23[C@](O2)([C@](OC3=O)(C[C@]4(C)[C@@](O4)(C=5OC(C[C@@H](C(C)=C)C1)=C(C=O)C5)[H])[H])[H]
Synonyms:- Lophotoxin
- (1R,2S,4S,10R,12R,14R,15R)-2-(Acetyloxy)-12-methyl-4-(1-methylethenyl)-17-oxo-11,16,18,19-tetraoxapentacyclo[12.2.2.16,9.01,15.010,12]nonadeca-6,8-diene-7-carboxaldehyde
- 11,16,18,19-Tetraoxapentacyclo[12.2.2.16,9.01,15.010,12]nonadeca-6,8-diene-7-carboxaldehyde, 2-(acetyloxy)-12-methyl-4-(1-methylethenyl)-17-oxo-, [1R-(1R*,2S*,4S*,10R*,12R*,14R*,15R*)]-
- 11,16,18,19-Tetraoxapentacyclo[12.2.2.16,9.01,15.010,12]nonadeca-6,8-diene-7-carboxaldehyde, 2-(acetyloxy)-12-methyl-4-(1-methylethenyl)-17-oxo-, (1R,2S,4S,10R,12R,14R,15R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lophotoxin
CAS:<p>Lophotoxin belongs to the cembrene class of diterpenoids; neuromuscular toxin isolated from several pacific gorgonians of the genus Lophogorgia.</p>Formula:C22H24O8Color and Shape:SolidMolecular weight:416.42
