CAS 787-27-9

2-(4-chlorophenyl)-3-phenylpropanoic acid

Description:

2-(4-Chlorophenyl)-3-phenylpropanoic acid, commonly known as flurbiprofen, is a nonsteroidal anti-inflammatory drug (NSAID) that exhibits analgesic and antipyretic properties. It is characterized by its ability to inhibit cyclooxygenase enzymes, leading to a decrease in the synthesis of prostaglandins, which are mediators of inflammation and pain. The compound features a propanoic acid backbone with a phenyl group and a para-chlorophenyl substituent, contributing to its lipophilicity and biological activity. Flurbiprofen is typically administered in its racemic form and is used to treat conditions such as arthritis, pain, and inflammation. Its pharmacokinetics involve absorption through the gastrointestinal tract, with metabolism primarily occurring in the liver. The substance is known for its potential side effects, including gastrointestinal discomfort and cardiovascular risks, which are common to many NSAIDs. As with any medication, it is essential to use flurbiprofen under medical supervision to mitigate risks and ensure appropriate therapeutic use.

Formula: C₁₅H₁₃ClO₂

InChI: InChI=1/C15H13ClO2/c16-13-8-6-12(7-9-13)14(15(17)18)10-11-4-2-1-3-5-11/h1-9,14H,10H2,(H,17,18)

SMILES: c1ccc(cc1)CC(c1ccc(cc1)Cl)C(=O)O

2-(4-Chlorophenyl)-3-phenylpropanoic acid

CAS: 787-27-9

Versatile small molecule scaffold

Formula: C₁₅H₁₃ClO₂

Purity: Min. 95%

Molecular weight: 260.71 g/mol

Ref: 3D-AAA78727