CAS 787-59-7
:4-amino-N-(2-methoxyphenyl)benzamide
Description:
4-Amino-N-(2-methoxyphenyl)benzamide, with the CAS number 787-59-7, is an organic compound characterized by its amide functional group and an amino group attached to a benzene ring. This compound features a methoxy group (-OCH3) on a phenyl ring, which influences its solubility and reactivity. The presence of both the amino and methoxy groups can enhance its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of polar functional groups, which can affect their solubility in various solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or improperly handled.
Formula:C14H14N2O2
InChI:InChI=1/C14H14N2O2/c1-18-13-5-3-2-4-12(13)16-14(17)10-6-8-11(15)9-7-10/h2-9H,15H2,1H3,(H,16,17)
SMILES:COc1ccccc1NC(=O)c1ccc(cc1)N
Synonyms:- 4-Amino-N-(2-methoxy-phenyl)-benzamide
- benzamide, 4-amino-N-(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
