CAS 78715-57-8
:2-[[diisopropoxyphosphoryl(fluoro)methyl]-isopropoxy-phosphoryl]oxypropane
Description:
2-[[Diisopropoxyphosphoryl(fluoro)methyl]-isopropoxy-phosphoryl]oxypropane, with CAS number 78715-57-8, is a complex organophosphorus compound characterized by its unique structure that includes multiple isopropoxy groups and a fluoromethyl moiety. This compound typically exhibits properties associated with organophosphates, such as potential biological activity and reactivity due to the presence of phosphorus and fluorine atoms. It may serve as an intermediate in the synthesis of more complex molecules or as a potential agrochemical or pharmaceutical agent. The presence of isopropoxy groups suggests that it may have moderate to low volatility and solubility in organic solvents. Additionally, the fluorine atom can impart unique electronic properties, potentially enhancing its reactivity or biological activity. Safety considerations are paramount, as organophosphates can exhibit toxicity, particularly in relation to their effects on the nervous system. Therefore, handling this compound requires appropriate safety measures to mitigate any health risks associated with exposure.
Formula:C13H29FO6P2
InChI:InChI=1/C13H29FO6P2/c1-9(2)17-21(15,18-10(3)4)13(14)22(16,19-11(5)6)20-12(7)8/h9-13H,1-8H3
SMILES:CC(C)OP(=O)(C(F)P(=O)(OC(C)C)OC(C)C)OC(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tetraisopropyl Fluoromethylenediphosphonate
CAS:Controlled ProductFormula:C13H29FO6P2Color and Shape:NeatMolecular weight:362.31
