CAS 78715-58-9

tetraethyl (difluoromethanediyl)bis(phosphonate)

Description:

Tetraethyl (difluoromethanediyl)bis(phosphonate), with the CAS number 78715-58-9, is an organophosphorus compound characterized by its dual phosphonate functional groups linked by a difluoromethanediyl moiety. This compound typically exhibits properties associated with phosphonates, such as high thermal stability and potential reactivity due to the presence of phosphorus-oxygen bonds. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The difluoromethanediyl group introduces unique electronic and steric properties, which can influence its reactivity and interactions with other chemical species. Tetraethyl (difluoromethanediyl)bis(phosphonate) may find applications in various fields, including agriculture as a pesticide or herbicide, and in materials science for the development of flame retardants or plasticizers. However, due to the presence of phosphorus and fluorine, it is essential to handle this compound with care, considering potential environmental and health impacts. Always refer to safety data sheets and regulatory guidelines when working with such substances.

Formula: C₉H₂₀F₂O₆P₂

InChI: InChI=1/C9H20F2O6P2/c1-5-14-18(12,15-6-2)9(10,11)19(13,16-7-3)17-8-4/h5-8H2,1-4H3

SMILES: CCOP(=O)(C(F)(F)P(=O)(OCC)OCC)OCC

Tetraethyl Difluoromethylenebisphosphonate

Controlled Product

CAS: 78715-58-9

Formula: C₉H₂₀F₂O₆P₂

Color and Shape: Neat

Molecular weight: 324.2

Ref: TR-T292965

Tetraethyl difluoromethylenebisphosphonate

CAS: 78715-58-9

Tetraethyl difluoromethylenebisphosphonate (Tefd) reacts with nucleophiles, such as alcohols and amines, to form tetraethyl pyrophosphate (TEPP), which is a powerful phosphorylating agent. TEPP has been used for the efficient synthesis of esters and amides from alcohols and amines, respectively. Tefd is also used in the synthesis of pyrophosphates from carboxylic acids.

Formula: C₉H₂₀F₂O₆P₂

Purity: Min. 95%

Color and Shape: Clear colourless to yellow oil.

Molecular weight: 324.2 g/mol

Ref: 3D-FT28078