CAS 78715-59-0
:P,P,P′,P′-Tetrakis(1-methylethyl) P,P′-(difluoromethylene)bis[phosphonate]
Description:
P,P,P′,P′-Tetrakis(1-methylethyl) P,P′-(difluoromethylene)bis[phosphonate], with CAS number 78715-59-0, is an organophosphorus compound characterized by its complex structure featuring multiple phosphonate groups. This substance typically exhibits properties associated with phosphonates, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is known for its potential applications in agriculture, particularly as a pesticide or herbicide, due to its ability to inhibit certain enzymatic processes in target organisms. The presence of difluoromethylene groups enhances its biological activity and stability. Additionally, the branched alkyl groups contribute to its lipophilicity, influencing its absorption and distribution in biological systems. Safety data indicates that, like many organophosphorus compounds, it should be handled with care due to potential toxicity. Overall, this compound exemplifies the diverse functionalities of phosphonates in chemical applications, particularly in agrochemicals.
Formula:C13H28F2O6P2
InChI:InChI=1/C13H28F2O6P2/c1-9(2)18-22(16,19-10(3)4)13(14,15)23(17,20-11(5)6)21-12(7)8/h9-12H,1-8H3
InChI key:InChIKey=QIZWQCNFQZUTJD-UHFFFAOYSA-N
SMILES:C(P(OC(C)C)(OC(C)C)=O)(P(OC(C)C)(OC(C)C)=O)(F)F
Synonyms:- Phosphonic acid, (difluoromethylene)bis-, tetrakis(1-methylethyl) ester
- Tetraisopropyl difluoromethylenebisphosphonate
- Phosphonic acid, P,P′-(difluoromethylene)bis-, P,P,P′,P′-tetrakis(1-methylethyl) ester
- Tetraisopropyl difluoromethylenediphosphonate
- P,P,P′,P′-Tetrakis(1-methylethyl) P,P′-(difluoromethylene)bis[phosphonate]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.