CAS 78734-65-3
:2-chloro-N-(1-cyanocyclopentyl)acetamide
Description:
2-Chloro-N-(1-cyanocyclopentyl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro group, an acetamide functional group, and a cyanocyclopentyl moiety. This compound typically appears as a solid or crystalline substance and is soluble in polar organic solvents. The presence of the chloro group contributes to its reactivity, making it a potential intermediate in organic synthesis. The cyanocyclopentyl group introduces a cyclic structure that can influence the compound's biological activity and interaction with other molecules. As with many amides, it may exhibit hydrogen bonding capabilities, affecting its physical properties such as melting point and boiling point. The compound's specific applications can vary, but it may be of interest in pharmaceutical research or as a building block in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as the presence of chlorine and cyanide groups can pose health risks.
Formula:C8H11ClN2O
InChI:InChI=1/C8H11ClN2O/c9-5-7(12)11-8(6-10)3-1-2-4-8/h1-5H2,(H,11,12)
InChI key:InChIKey=UVKBLHXZVPGUPL-UHFFFAOYSA-N
SMILES:C1CCC(C1)(C#N)N=C(CCl)O
Synonyms:- 2-Chlor-N-(1-cyancyclopentyl)acetamid
- 2-Chloro-n-(1-cyano-cyclopentyl)-acetamide
- acetamide, 2-chloro-N-(1-cyanocyclopentyl)-
- 2-Chloro-N-(1-cyanocyclopentyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
