CAS 78734-78-8

2-chloro-N-(1-cyanocyclohexyl)acetamide

Description:

2-Chloro-N-(1-cyanocyclohexyl)acetamide, with the CAS number 78734-78-8, is a chemical compound characterized by its unique structure, which includes a chloro group and a cyanocyclohexyl moiety attached to an acetamide functional group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the chloro substituent. The cyanocyclohexyl group may impart specific steric and electronic effects, influencing its reactivity and interactions with biological systems. As a result, this compound may be of interest in medicinal chemistry and pharmaceutical applications, particularly in the development of novel therapeutic agents. Its synthesis and handling require standard laboratory safety protocols due to the presence of chlorine, which can be hazardous. Overall, 2-chloro-N-(1-cyanocyclohexyl)acetamide represents a compound with potential utility in various chemical and biological contexts, warranting further investigation into its properties and applications.

Formula: C₉H₁₃ClN₂O

InChI: InChI=1/C9H13ClN2O/c10-6-8(13)12-9(7-11)4-2-1-3-5-9/h1-6H2,(H,12,13)

SMILES: C1CCC(CC1)(C#N)N=C(CCl)O

Synonyms:

• 2-Chlor-N-(1-cyancyclohexyl)acetamid
• acetamide, 2-chloro-N-(1-cyanocyclohexyl)-
• 2-Chloro-N-(1-cyanocyclohexyl)acetamide

2-Chloro-N-(1-cyanocyclohexyl)acetamide

CAS: 78734-78-8

Versatile small molecule scaffold

Formula: C₉H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 200.66 g/mol

Ref: 3D-DDA73478