CAS 78735-01-0

2-chloro-N-(1-cyanocycloheptyl)acetamide

Description:

2-Chloro-N-(1-cyanocycloheptyl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro group, an acetamide functional group, and a cyanocycloheptyl moiety. This compound typically appears as a solid or crystalline substance and is soluble in polar organic solvents. The presence of the chloro group contributes to its reactivity, making it a potential intermediate in organic synthesis. The cyanocycloheptyl group introduces a cyclic structure that can influence the compound's steric and electronic properties, potentially affecting its biological activity. As with many amides, it may exhibit hydrogen bonding capabilities, which can impact its solubility and interaction with other molecules. The compound's specific applications may vary, but it is often explored in medicinal chemistry for its potential pharmacological properties. Safety data should be consulted for handling and storage, as the presence of chlorine and cyanide functionalities may pose health risks. Overall, 2-chloro-N-(1-cyanocycloheptyl)acetamide represents a complex organic molecule with diverse chemical characteristics.

Formula: C₁₀H₁₅ClN₂O

InChI: InChI=1/C10H15ClN2O/c11-7-9(14)13-10(8-12)5-3-1-2-4-6-10/h1-7H2,(H,13,14)

Synonyms:

• acetamide, 2-chloro-N-(1-cyanocycloheptyl)-
• 2-Chlor-N-(1-cyancycloheptyl)acetamid