CymitQuimica logo

CAS 78739-39-6

:

Hispidol B

Description:
Hispidol B, with the CAS number 78739-39-6, is a naturally occurring chemical compound classified as a flavonoid. It is primarily derived from certain plant sources, particularly those within the genus *Hispidula*. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential antimicrobial properties, making it of interest in pharmacological research. Flavonoids like Hispidol B are known for their ability to scavenge free radicals, which can contribute to cellular protection against oxidative stress. Additionally, Hispidol B may play a role in modulating various biochemical pathways, potentially influencing health outcomes. Its structural characteristics typically include a polyphenolic framework, which is common among flavonoids, contributing to its reactivity and interaction with biological systems. Research into Hispidol B is ongoing, focusing on its therapeutic potential and mechanisms of action, particularly in the context of chronic diseases where oxidative stress is a contributing factor.
Formula:C30H52O4
InChI:InChI=1S/C30H52O4/c1-18(17-22(31)25(33)27(4,5)34)19-11-15-30(8)21-9-10-23-26(2,3)24(32)13-14-28(23,6)20(21)12-16-29(19,30)7/h9,18-20,22-25,31-34H,10-17H2,1-8H3/t18-,19-,20-,22+,23-,24-,25-,28+,29-,30+/m0/s1
InChI key:InChIKey=MVWLZBQPRMCRKT-ZAVAKTSASA-N
SMILES:C[C@@]12[C@@]3(C([C@]4(C)[C@@](C)(CC3)[C@]([C@H](C[C@H]([C@@H](C(C)(C)O)O)O)C)(CC4)[H])=CC[C@]1(C(C)(C)[C@@H](O)CC2)[H])[H]
Synonyms:
  • (3β,13α,14β,17α,20S,23R,24S)-Lanost-7-ene-3,23,24,25-tetrol
  • Hispidol B
  • Lanost-7-ene-3,23,24,25-tetrol, (3β,13α,14β,17α,20S,23R,24S)-
  • Piscidinol B
  • (3S,23R,24S)-Tirucall-7-ene-3,23,24,25-tetrol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Hispidol B

    CAS:
    Hispidol B is a useful organic compound for research related to life sciences. The catalog number is T124216 and the CAS number is 78739-39-6.
    Formula:C30H52O4
    Color and Shape:Solid
    Molecular weight:476.742

    Ref: TM-T124216

    1mg
    To inquire
    5mg
    To inquire