CymitQuimica logo

CAS 78743-00-7

:

ethyl {2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl}acetate

Description:
Ethyl {2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl}acetate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a trifluoromethyl group on the phenyl ring enhances its lipophilicity and can influence its biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, reflecting its non-polar characteristics due to the trifluoromethyl group. Ethyl {2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl}acetate may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis often involves the reaction of thiazole derivatives with ethyl acetate or related reagents. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with this compound.
Formula:C14H12F3NO2S
InChI:InChI=1/C14H12F3NO2S/c1-2-20-12(19)7-11-8-21-13(18-11)9-4-3-5-10(6-9)14(15,16)17/h3-6,8H,2,7H2,1H3
SMILES:CCOC(=O)Cc1csc(c2cccc(c2)C(F)(F)F)n1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.