CymitQuimica logo

CAS 78743-65-4

:

N-2-Hydroxyethyl-1-adamantylformamide

Description:
N-2-Hydroxyethyl-1-adamantylformamide, with the CAS number 78743-65-4, is a chemical compound characterized by its unique structure that combines an adamantyl group with a formamide functional group and a hydroxyethyl substituent. The adamantyl moiety contributes to its rigidity and hydrophobic properties, while the hydroxyethyl group introduces hydrophilicity and potential for hydrogen bonding. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxy group. Its formamide functionality suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The presence of both hydrophobic and hydrophilic characteristics may also influence its behavior in biological systems, making it a candidate for further research in drug formulation or delivery systems. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C13H21NO2
InChI:InChI=1S/C13H21NO2/c15-2-1-14-12(16)13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11,15H,1-8H2,(H,14,16)
SMILES:C(CO)N=C(C12CC3CC(CC(C3)C2)C1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.