CymitQuimica logo

CAS 78750-68-2

:

4-[(3-Amino-2-pyridinyl)amino]phenol

Description:
4-[(3-Amino-2-pyridinyl)amino]phenol, with the CAS number 78750-68-2, is an organic compound characterized by its aromatic structure, which includes a phenolic group and an amino-pyridine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of amino and hydroxyl functional groups. It may display basic characteristics due to the amino groups, allowing it to participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. The presence of both amino and hydroxyl groups suggests potential applications in pharmaceuticals, particularly in drug development, as these functional groups can enhance biological activity and solubility. Additionally, the compound may exhibit antioxidant properties, making it of interest in biochemical research. Its stability and reactivity can be influenced by pH and the presence of other chemical species in the environment. Overall, 4-[(3-Amino-2-pyridinyl)amino]phenol is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C11H11N3O
InChI:InChI=1S/C11H11N3O/c12-10-2-1-7-13-11(10)14-8-3-5-9(15)6-4-8/h1-7,15H,12H2,(H,13,14)
InChI key:InChIKey=VDKIMNUBAYDJEU-UHFFFAOYSA-N
SMILES:N(C1=C(N)C=CC=N1)C2=CC=C(O)C=C2
Synonyms:
  • 4-[(3-AMINOPYRIDIN-2-YL)AMINO]PHENOL
  • 4-[(3-Amino-2-pyridinyl)amino]phenol
  • Phenol, 4-[(3-amino-2-pyridinyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.