
CAS 78751-58-3
:2-Pyrenol
Description:
2-Pyrenol, with the CAS number 78751-58-3, is an organic compound that belongs to the class of polycyclic aromatic hydrocarbons. It is characterized by a pyrene backbone with a hydroxyl (-OH) group positioned at the second carbon atom. This compound typically appears as a solid or crystalline substance and is known for its aromatic properties. 2-Pyrenol is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic nature. It exhibits fluorescence, making it useful in various applications, including as a fluorescent probe in biochemical studies. The presence of the hydroxyl group enhances its reactivity, allowing it to participate in various chemical reactions, such as oxidation and substitution. Additionally, 2-Pyrenol can serve as an intermediate in the synthesis of other chemical compounds and is studied for its potential environmental and biological effects, particularly in relation to its behavior as a pollutant and its interactions with biological systems.
Formula:C16H10O
InChI:InChI=1S/C16H10O/c17-14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9,17H
InChI key:InChIKey=NKFFJDXMGAZKEQ-UHFFFAOYSA-N
SMILES:OC=1C=C2C3=C4C(=CC=C3C1)C=CC=C4C=C2
Synonyms:- 2-Pyrenol
- 2-Hydroxypyrene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.