CAS 78754-81-1

5-chloroquinazoline-2,4(1H,3H)-dione

Description:

5-Chloroquinazoline-2,4(1H,3H)-dione is a heterocyclic organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the 5-position and two carbonyl groups at the 2 and 4 positions contributes to its reactivity and potential biological activity. This compound is typically a crystalline solid and is soluble in organic solvents, reflecting its non-polar characteristics. It may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in pharmaceutical research. The compound's molecular structure allows for various chemical modifications, which can enhance its biological efficacy or alter its pharmacokinetic properties. As with many quinazoline derivatives, it may interact with specific biological targets, including enzymes or receptors, contributing to its therapeutic potential. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₅ClN₂O₂

InChI: InChI=1/C8H5ClN2O2/c9-4-2-1-3-5-6(4)7(12)11-8(13)10-5/h1-3H,(H2,10,11,12,13)

SMILES: c1cc(c2c(c1)nc(nc2O)O)Cl

Synonyms:

• 2,4(1H,3H)-quinazolinedione, 5-chloro-
• 5-Chloroquinazoline-2,4-Diol
• 5-Chloroquinazoline-2,4(1H,3H)-dione

5-Chloroquinazoline-2,4-diol

CAS: 78754-81-1

Formula: C₈H₅ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 196.5905

Ref: IN-DA003MOX

5-Chloroquinazoline-2,4(1H,3H)-dione

CAS: 78754-81-1

5-Chloroquinazoline-2,4(1H,3H)-dione

Purity: 98%

Molecular weight: 196.59g/mol

Ref: 54-OR927915

5-Chloroquinazoline-2,4-diol

CAS: 78754-81-1

Formula: C₈H₅ClN₂O₂

Purity: 98%

Molecular weight: 196.59

Ref: 10-F091580