CymitQuimica logo

CAS 78754-92-4

:

imidazo[1,2-c]quinazoline-2,5(3H,6H)-dione

Description:
Imidazo[1,2-c]quinazoline-2,5(3H,6H)-dione is a heterocyclic compound characterized by its fused imidazole and quinazoline rings, which contribute to its unique chemical properties. This compound typically exhibits a solid-state structure and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the dione functional groups suggests it may participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding, which can influence its reactivity and interactions with biological targets. Its molecular structure allows for the possibility of forming derivatives that may enhance its pharmacological properties. Additionally, compounds of this class may exhibit fluorescence, making them useful in imaging applications. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in both laboratory and pharmaceutical contexts. Overall, imidazo[1,2-c]quinazoline-2,5(3H,6H)-dione represents a versatile scaffold for further research and development in drug discovery.
Formula:C10H7N3O2
InChI:InChI=1/C10H7N3O2/c14-8-5-13-9(12-8)6-3-1-2-4-7(6)11-10(13)15/h1-4H,5H2,(H,11,15)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.