CAS 787548-29-2
:ethyl 1-amino-2-ethenylcyclopropanecarboxylate
Description:
Ethyl 1-amino-2-ethenylcyclopropanecarboxylate, identified by its CAS number 787548-29-2, is a chemical compound characterized by its unique structure that includes an ethyl ester group, an amino group, and a cyclopropane ring. This compound typically exhibits properties associated with both amines and esters, such as potential reactivity in nucleophilic substitution and condensation reactions. The presence of the cyclopropane moiety contributes to its rigidity and may influence its reactivity and stability. Ethyl 1-amino-2-ethenylcyclopropanecarboxylate may also display polar characteristics due to the amino and carboxylate functionalities, which can affect its solubility in various solvents. Additionally, the compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its structural features that can facilitate further chemical transformations. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through appropriate studies.
Formula:C8H13NO2
InChI:InChI=1/C8H13NO2/c1-3-6-5-8(6,9)7(10)11-4-2/h3,6H,1,4-5,9H2,2H3
SMILES:C=CC1CC1(C(=O)OCC)N
Synonyms:- Ethyl 1-Amino-2-Vinylcyclopropanecarboxylate
- Ethyl-1-amino-2-vinylcyclopropancarboxylat
- Cyclopropanecarboxylic acid,1-amino-2-ethenyl-,ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
