CymitQuimica logo

CAS 787554-04-5

:

N-[(2S)-1-{[tert-butyl(diphenyl)silyl]oxy}-3-(1-methyl-1H-imidazol-5-yl)propan-2-yl]-2,4,6-tri(propan-2-yl)benzenesulfonamide

Description:
N-[(2S)-1-{[tert-butyl(diphenyl)silyl]oxy}-3-(1-methyl-1H-imidazol-5-yl)propan-2-yl]-2,4,6-tri(propan-2-yl)benzenesulfonamide is a complex organic compound characterized by its intricate molecular structure, which includes a sulfonamide functional group, a chiral center, and multiple substituents that contribute to its overall properties. The presence of the tert-butyl(diphenyl)silyl group suggests significant steric hindrance, which may influence its reactivity and solubility. The imidazole ring indicates potential biological activity, as imidazole derivatives are often found in pharmaceuticals. The compound's sulfonamide moiety is known for its antibacterial properties, although the specific activity would depend on the overall structure and substituents. Additionally, the presence of isopropyl groups may enhance lipophilicity, affecting its pharmacokinetics. Overall, this compound's unique characteristics make it a subject of interest in medicinal chemistry and material science, although detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C38H53N3O3SSi
InChI:InChI=1/C38H53N3O3SSi/c1-27(2)30-21-35(28(3)4)37(36(22-30)29(5)6)45(42,43)40-31(23-32-24-39-26-41(32)10)25-44-46(38(7,8)9,33-17-13-11-14-18-33)34-19-15-12-16-20-34/h11-22,24,26-29,31,40H,23,25H2,1-10H3/t31-/m0/s1
SMILES:CC(C)c1cc(C(C)C)c(c(c1)C(C)C)S(=O)(=O)N[C@@H](Cc1cncn1C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.